About ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate
ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate (PubChem CID 20833918) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate.
Molecular Properties
| Compound Name | ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate |
| PubChem CID | 20833918 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate |
| SMILES | CCCC(C(=O)OCC)C1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C11H18N2O4/c1-4-6-7(8(14)17-5-2)11(3)9(15)12-10(16)13-11/h7H,4-6H2,1-3H3,(H2,12,13,15,16) |
| InChIKey | BIDYIAOOCBFMQV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate?
The IUPAC name of ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate (CID 20833918) is ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate.
What is the SMILES notation for ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate?
The canonical SMILES for ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate is CCCC(C(=O)OCC)C1(C)NC(=O)NC1=O.
What is the InChIKey of ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate?
The InChIKey is BIDYIAOOCBFMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-4-6-7(8(14)17-5-2)11(3)9(15)12-10(16)13-11/h7H,4-6H2,1-3H3,(H2,12,13,15,16).
What are the key properties of ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate?
ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate has a molecular weight of 242.27 g/mol, XLogP of 0.56, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)pentanoate is sourced from PubChem (CID 20833918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).