C7H16O2S — CID 20834293
2-Propanol, 1-[1-methyl-2-(methylthio)ethoxy]- (PubChem CID 20834293) has the molecular formula C7H16O2S and a molecular weight of 164.27 g/mol. Its IUPAC name is 1-(1-methylsulfanylpropan-2-yloxy)propan-2-ol.
| Compound Name | 2-Propanol, 1-[1-methyl-2-(methylthio)ethoxy]- |
|---|---|
| PubChem CID | 20834293 |
| Molecular Formula | C7H16O2S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-(1-methylsulfanylpropan-2-yloxy)propan-2-ol |
| SMILES | CC(COC(C)CSC)O |
| InChI | InChI=1S/C7H16O2S/c1-6(8)4-9-7(2)5-10-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | WYHWTENYOVYBQX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | 78 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |