C17H8F5NO3 — CID 20834596
(4E)-2-(4-methoxyphenyl)-4-[(2,3,4,5,6-pentafluorophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 20834596) has the molecular formula C17H8F5NO3 and a molecular weight of 369.25 g/mol. Its IUPAC name is (4E)-2-(4-methoxyphenyl)-4-[(2,3,4,5,6-pentafluorophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-methoxyphenyl)-4-[(2,3,4,5,6-pentafluorophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 20834596 |
| Molecular Formula | C17H8F5NO3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | (4E)-2-(4-methoxyphenyl)-4-[(2,3,4,5,6-pentafluorophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=N/C(=C/c3c(F)c(F)c(F)c(F)c3F)C(=O)O2)cc1 |
| InChI | InChI=1S/C17H8F5NO3/c1-25-8-4-2-7(3-5-8)16-23-10(17(24)26-16)6-9-11(18)13(20)15(22)14(21)12(9)19/h2-6H,1H3/b10-6+ |
| InChIKey | CUTQMPDWWQRTTJ-UXBLZVDNSA-N |
| XLogP | 3.74 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|