C21H27Cl2NO — CID 20834604
N-(3,4-dichlorophenyl)-2-[(4Z,8Z)-12-methylcyclododeca-4,8-dien-1-yl]acetamide (PubChem CID 20834604) has the molecular formula C21H27Cl2NO and a molecular weight of 380.36 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[(4Z,8Z)-12-methylcyclododeca-4,8-dien-1-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[(4Z,8Z)-12-methylcyclododeca-4,8-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 20834604 |
| Molecular Formula | C21H27Cl2NO |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[(4Z,8Z)-12-methylcyclododeca-4,8-dien-1-yl]acetamide |
| SMILES | CC1CC/C=C\CC/C=C\CCC1CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H27Cl2NO/c1-16-10-8-6-4-2-3-5-7-9-11-17(16)14-21(25)24-18-12-13-19(22)20(23)15-18/h4-7,12-13,15-17H,2-3,8-11,14H2,1H3,(H,24,25)/b6-4-,7-5- |
| InChIKey | FWYAWHVQUBCRSV-PEPZGXQESA-N |
| XLogP | 7.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|