About [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 2083531) has the molecular formula C16H18N2O5S
and a molecular weight of 350.40 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate.
Molecular Properties
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate |
| PubChem CID | 2083531 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)CCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H18N2O5S/c1-2-22-16(21)18-13(19)10-23-15(20)9-5-8-14-17-11-6-3-4-7-12(11)24-14/h3-4,6-7H,2,5,8-10H2,1H3,(H,18,19,21) |
| InChIKey | VRIUPDABBMFPHK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate?
The IUPAC name of [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate (CID 2083531) is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate.
What is the SMILES notation for [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate?
The canonical SMILES for [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate is CCOC(=O)NC(=O)COC(=O)CCCc1nc2ccccc2s1.
What is the InChIKey of [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate?
The InChIKey is VRIUPDABBMFPHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5S/c1-2-22-16(21)18-13(19)10-23-15(20)9-5-8-14-17-11-6-3-4-7-12(11)24-14/h3-4,6-7H,2,5,8-10H2,1H3,(H,18,19,21).
What are the key properties of [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate?
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate has a molecular weight of 350.40 g/mol, XLogP of 2.43, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(ethoxycarbonylamino)-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate is sourced from PubChem (CID 2083531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).