C29H25N7O2S2 — CID 20835317
4-[(Z,3E)-3-(carbamothioylhydrazinylidene)-3-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]prop-1-enyl]-N-hydroxybenzeneamine oxide (PubChem CID 20835317) has the molecular formula C29H25N7O2S2 and a molecular weight of 567.70 g/mol. Its IUPAC name is 4-[(Z,3E)-3-(carbamothioylhydrazinylidene)-3-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]prop-1-enyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[(Z,3E)-3-(carbamothioylhydrazinylidene)-3-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]prop-1-enyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 20835317 |
| Molecular Formula | C29H25N7O2S2 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 4-[(Z,3E)-3-(carbamothioylhydrazinylidene)-3-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]prop-1-enyl]-N-hydroxybenzeneamine oxide |
| SMILES | Cc1nc(-n2nc(-c3ccccc3)cc2-c2ccccc2)sc1C(/C=C\c1ccc([NH+]([O-])O)cc1)=N/NC(N)=S |
| InChI | InChI=1S/C29H25N7O2S2/c1-19-27(24(32-33-28(30)39)17-14-20-12-15-23(16-13-20)36(37)38)40-29(31-19)35-26(22-10-6-3-7-11-22)18-25(34-35)21-8-4-2-5-9-21/h2-18,36-37H,1H3,(H3,30,33,39)/b17-14-,32-24+ |
| InChIKey | KDKQIEPKTVBBKC-WHRMNIKVSA-N |
| XLogP | 4.63 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|