C29H47N — CID 20835550
(2E)-2-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-ylidene]acetonitrile (PubChem CID 20835550) has the molecular formula C29H47N and a molecular weight of 409.70 g/mol. Its IUPAC name is (2E)-2-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-ylidene]acetonitrile.
| Compound Name | (2E)-2-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-ylidene]acetonitrile |
|---|---|
| PubChem CID | 20835550 |
| Molecular Formula | C29H47N |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 409.37 |
| IUPAC Name | (2E)-2-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-ylidene]acetonitrile |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C/C(=C\C#N)C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H47N/c1-20(2)9-8-10-21(3)24-12-13-26-23-19-22(15-18-30)25-11-6-7-16-28(25,4)27(23)14-17-29(24,26)5/h15,20-21,23-27H,6-14,16-17,19H2,1-5H3/b22-15+/t21-,23+,24-,25?,26+,27+,28+,29-/m1/s1 |
| InChIKey | LJPNKLWQUQWNIQ-OSKRNORLSA-N |
| XLogP | 8.56 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|