C29H31N7O9 — CID 20835679
(2R,4S)-2-amino-4-[4-[[2-[4-[[4-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]phenyl]diazenyl]anilino]-2-oxoethyl]amino]-4-oxobutyl]pentanedioic acid (PubChem CID 20835679) has the molecular formula C29H31N7O9 and a molecular weight of 621.61 g/mol. Its IUPAC name is (2R,4S)-2-amino-4-[4-[[2-[4-[[4-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]phenyl]diazenyl]anilino]-2-oxoethyl]amino]-4-oxobutyl]pentanedioic acid.
| Compound Name | (2R,4S)-2-amino-4-[4-[[2-[4-[[4-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]phenyl]diazenyl]anilino]-2-oxoethyl]amino]-4-oxobutyl]pentanedioic acid |
|---|---|
| PubChem CID | 20835679 |
| Molecular Formula | C29H31N7O9 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | (2R,4S)-2-amino-4-[4-[[2-[4-[[4-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]phenyl]diazenyl]anilino]-2-oxoethyl]amino]-4-oxobutyl]pentanedioic acid |
| SMILES | N[C@H](CC(CCCC(=O)NCC(=O)Nc1ccc(/N=N/c2ccc(NC(=O)CN3C(=O)C=CC3=O)cc2)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C29H31N7O9/c30-22(29(44)45)14-17(28(42)43)2-1-3-23(37)31-15-24(38)32-18-4-8-20(9-5-18)34-35-21-10-6-19(7-11-21)33-25(39)16-36-26(40)12-13-27(36)41/h4-13,17,22H,1-3,14-16,30H2,(H,31,37)(H,32,38)(H,33,39)(H,42,43)(H,44,45)/b35-34+/t17?,22-/m1/s1 |
| InChIKey | SWTLBOZBWQYMRX-LDKFVITOSA-N |
| XLogP | 1.69 |
| TPSA | 250.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|