C9H18NO4PS2 — CID 20836038
ethyl 2-[[2-[ethoxy(methyl)phosphinothioyl]sulfanylacetyl]amino]acetate (PubChem CID 20836038) has the molecular formula C9H18NO4PS2 and a molecular weight of 299.35 g/mol. Its IUPAC name is ethyl 2-[[2-[ethoxy(methyl)phosphinothioyl]sulfanylacetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[ethoxy(methyl)phosphinothioyl]sulfanylacetyl]amino]acetate |
|---|---|
| PubChem CID | 20836038 |
| Molecular Formula | C9H18NO4PS2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | ethyl 2-[[2-[ethoxy(methyl)phosphinothioyl]sulfanylacetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CSP(C)(=S)OCC |
| InChI | InChI=1S/C9H18NO4PS2/c1-4-13-9(12)6-10-8(11)7-17-15(3,16)14-5-2/h4-7H2,1-3H3,(H,10,11) |
| InChIKey | BTLMTRPTWKZJGU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|