C26H46N2O4 — CID 20836295
2-[acetyl-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]ethyl]amino]ethyl acetate (PubChem CID 20836295) has the molecular formula C26H46N2O4 and a molecular weight of 450.66 g/mol. Its IUPAC name is 2-[acetyl-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]ethyl]amino]ethyl acetate.
| Compound Name | 2-[acetyl-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]ethyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 20836295 |
| Molecular Formula | C26H46N2O4 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | 2-[acetyl-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]ethyl]amino]ethyl acetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCCN(CCOC(C)=O)C(C)=O |
| InChI | InChI=1S/C26H46N2O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(31)27-20-21-28(24(2)29)22-23-32-25(3)30/h8-9,11-12H,4-7,10,13-23H2,1-3H3,(H,27,31)/b9-8-,12-11- |
| InChIKey | KXHHGVXKLUUNOS-MURFETPASA-N |
| XLogP | 5.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|