About ethyl prop-1-ene-2-sulfinate
ethyl prop-1-ene-2-sulfinate (PubChem CID 20836372) has the molecular formula C5H10O2S
and a molecular weight of 134.20 g/mol. Its IUPAC name is ethyl prop-1-ene-2-sulfinate.
Molecular Properties
| Compound Name | ethyl prop-1-ene-2-sulfinate |
| PubChem CID | 20836372 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | ethyl prop-1-ene-2-sulfinate |
| SMILES | C=C(C)S(=O)OCC |
| InChI | InChI=1S/C5H10O2S/c1-4-7-8(6)5(2)3/h2,4H2,1,3H3 |
| InChIKey | IWVURRDFUVJNRM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl prop-1-ene-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-1-ene-2-sulfinate?
The IUPAC name of ethyl prop-1-ene-2-sulfinate (CID 20836372) is ethyl prop-1-ene-2-sulfinate.
What is the SMILES notation for ethyl prop-1-ene-2-sulfinate?
The canonical SMILES for ethyl prop-1-ene-2-sulfinate is C=C(C)S(=O)OCC.
What is the InChIKey of ethyl prop-1-ene-2-sulfinate?
The InChIKey is IWVURRDFUVJNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2S/c1-4-7-8(6)5(2)3/h2,4H2,1,3H3.
What are the key properties of ethyl prop-1-ene-2-sulfinate?
ethyl prop-1-ene-2-sulfinate has a molecular weight of 134.20 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-1-ene-2-sulfinate is sourced from PubChem (CID 20836372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).