About 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione
5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione (PubChem CID 20836574) has the molecular formula C11H22N2O5Si
and a molecular weight of 290.39 g/mol. Its IUPAC name is 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione |
| PubChem CID | 20836574 |
| Molecular Formula | C11H22N2O5Si |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione |
| SMILES | CO[Si](CCCN1C(=O)NC(C)(C)C1=O)(OC)OC |
| InChI | InChI=1S/C11H22N2O5Si/c1-11(2)9(14)13(10(15)12-11)7-6-8-19(16-3,17-4)18-5/h6-8H2,1-5H3,(H,12,15) |
| InChIKey | MGXBYLATDIACQU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione?
The IUPAC name of 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione (CID 20836574) is 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione?
The canonical SMILES for 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione is CO[Si](CCCN1C(=O)NC(C)(C)C1=O)(OC)OC.
What is the InChIKey of 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione?
The InChIKey is MGXBYLATDIACQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O5Si/c1-11(2)9(14)13(10(15)12-11)7-6-8-19(16-3,17-4)18-5/h6-8H2,1-5H3,(H,12,15).
What are the key properties of 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione?
5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione has a molecular weight of 290.39 g/mol, XLogP of 0.58, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-(3-trimethoxysilylpropyl)imidazolidine-2,4-dione is sourced from PubChem (CID 20836574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).