C23H20BrN — CID 20837591
(2-bromophenyl)-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine (PubChem CID 20837591) has the molecular formula C23H20BrN and a molecular weight of 390.32 g/mol. Its IUPAC name is (2-bromophenyl)-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine.
| Compound Name | (2-bromophenyl)-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine |
|---|---|
| PubChem CID | 20837591 |
| Molecular Formula | C23H20BrN |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (2-bromophenyl)-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)methanimine |
| SMILES | [H]/N=C(/c1ccccc1Br)c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C23H20BrN/c24-22-4-2-1-3-20(22)23(25)21-15-18-10-9-16-5-7-17(8-6-16)11-13-19(21)14-12-18/h1-8,12,14-15,25H,9-11,13H2/b25-23- |
| InChIKey | ZWKOAWYOZAZPOE-BZZOAKBMSA-N |
| XLogP | 5.75 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|