C14H26O2 — CID 20837618
5,5,6-trimethylundec-3-yne-2,2-diol (PubChem CID 20837618) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 5,5,6-trimethylundec-3-yne-2,2-diol.
| Compound Name | 5,5,6-trimethylundec-3-yne-2,2-diol |
|---|---|
| PubChem CID | 20837618 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 5,5,6-trimethylundec-3-yne-2,2-diol |
| SMILES | CCCCCC(C)C(C)(C)C#CC(C)(O)O |
| InChI | InChI=1S/C14H26O2/c1-6-7-8-9-12(2)13(3,4)10-11-14(5,15)16/h12,15-16H,6-9H2,1-5H3 |
| InChIKey | AGGCEDYMGLPKNS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|