C15H24O — CID 20837788
(1R,6S,7S,10S)-4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,6]undec-4-ene (PubChem CID 20837788) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (1R,6S,7S,10S)-4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,6]undec-4-ene.
| Compound Name | (1R,6S,7S,10S)-4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,6]undec-4-ene |
|---|---|
| PubChem CID | 20837788 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1R,6S,7S,10S)-4,10-dimethyl-7-propan-2-yl-11-oxatricyclo[6.2.1.01,6]undec-4-ene |
| SMILES | CC1=C[C@H]2[C@H](C(C)C)C3C[C@H](C)[C@@]2(CC1)O3 |
| InChI | InChI=1S/C15H24O/c1-9(2)14-12-7-10(3)5-6-15(12)11(4)8-13(14)16-15/h7,9,11-14H,5-6,8H2,1-4H3/t11-,12-,13?,14-,15+/m0/s1 |
| InChIKey | DQYKEJCVAMRGAR-UUQIVFDPSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|