C11H16N2NaO3+ — CID 20838018
sodium 5-ethyl-5-[(E)-pent-2-en-2-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 20838018) has the molecular formula C11H16N2NaO3+ and a molecular weight of 247.25 g/mol. Its IUPAC name is sodium 5-ethyl-5-[(E)-pent-2-en-2-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | sodium 5-ethyl-5-[(E)-pent-2-en-2-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20838018 |
| Molecular Formula | C11H16N2NaO3+ |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | sodium 5-ethyl-5-[(E)-pent-2-en-2-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC/C=C(\C)C1(CC)C(=O)NC(=O)NC1=O.[Na+] |
| InChI | InChI=1S/C11H16N2O3.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;/h6H,4-5H2,1-3H3,(H2,12,13,14,15,16);/q;+1/b7-6+; |
| InChIKey | OQLZQQCXUHKXAD-UHDJGPCESA-N |
| XLogP | -1.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|