morpholine;(Z)-octadec-9-enoic acid

C22H43NO3 — CID 20838052

IUPACmorpholine;(Z)-octadec-9-enoic acid
SMILESC1COCCN1.CCCCCCCC/C=C\CCCCCCCC(=O)O
InChIInChI=1S/C18H34O2.C4H9NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-6-4-2-5-1/h9-10H,2-8,11-17H2,1H3,(H,19,20);5H,1-4H2/b10-9-;
InChIKeyOBMBYGXRLQQDHH-KVVVOXFISA-N
MW369.59 g/mol
LogP5.71
Rot. Bonds15

About morpholine;(Z)-octadec-9-enoic acid

morpholine;(Z)-octadec-9-enoic acid (PubChem CID 20838052) has the molecular formula C22H43NO3 and a molecular weight of 369.59 g/mol. Its IUPAC name is morpholine;(Z)-octadec-9-enoic acid.

Molecular Properties

Compound Namemorpholine;(Z)-octadec-9-enoic acid
PubChem CID20838052
Molecular FormulaC22H43NO3
Molecular Weight369.59 g/mol
Exact Mass369.32
IUPAC Namemorpholine;(Z)-octadec-9-enoic acid
SMILESC1COCCN1.CCCCCCCC/C=C\CCCCCCCC(=O)O
InChIInChI=1S/C18H34O2.C4H9NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-6-4-2-5-1/h9-10H,2-8,11-17H2,1H3,(H,19,20);5H,1-4H2/b10-9-;
InChIKeyOBMBYGXRLQQDHH-KVVVOXFISA-N
XLogP5.71
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds15
Heavy Atoms26
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500369.59
LogP ≤ 55.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze morpholine;(Z)-octadec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholine;(Z)-octadec-9-enoic acid?
The IUPAC name of morpholine;(Z)-octadec-9-enoic acid (CID 20838052) is morpholine;(Z)-octadec-9-enoic acid.
What is the SMILES notation for morpholine;(Z)-octadec-9-enoic acid?
The canonical SMILES for morpholine;(Z)-octadec-9-enoic acid is C1COCCN1.CCCCCCCC/C=C\CCCCCCCC(=O)O.
What is the InChIKey of morpholine;(Z)-octadec-9-enoic acid?
The InChIKey is OBMBYGXRLQQDHH-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C4H9NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-6-4-2-5-1/h9-10H,2-8,11-17H2,1H3,(H,19,20);5H,1-4H2/b10-9-;.
What are the key properties of morpholine;(Z)-octadec-9-enoic acid?
morpholine;(Z)-octadec-9-enoic acid has a molecular weight of 369.59 g/mol, XLogP of 5.71, 15 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 20838052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).