C26H31NO4 — CID 20838299
(Z)-but-2-enedioic acid;(Z)-N-methyl-4-phenyl-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)but-3-en-1-amine (PubChem CID 20838299) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(Z)-N-methyl-4-phenyl-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)but-3-en-1-amine.
| Compound Name | (Z)-but-2-enedioic acid;(Z)-N-methyl-4-phenyl-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)but-3-en-1-amine |
|---|---|
| PubChem CID | 20838299 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;(Z)-N-methyl-4-phenyl-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)but-3-en-1-amine |
| SMILES | CNCC/C=C(/c1ccccc1)c1ccc2c(c1)CCCCC2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H27N.C4H4O4/c1-23-16-8-13-22(19-10-5-3-6-11-19)21-15-14-18-9-4-2-7-12-20(18)17-21;5-3(6)1-2-4(7)8/h3,5-6,10-11,13-15,17,23H,2,4,7-9,12,16H2,1H3;1-2H,(H,5,6)(H,7,8)/b22-13-;2-1- |
| InChIKey | HDYLAGQNSVZAMA-GOALDZADSA-N |
| XLogP | 4.71 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|