About (11Z)-1-iminoicosa-1,11-dien-3-one
(11Z)-1-iminoicosa-1,11-dien-3-one (PubChem CID 20838345) has the molecular formula C20H35NO
and a molecular weight of 305.51 g/mol. Its IUPAC name is (11Z)-1-iminoicosa-1,11-dien-3-one.
Molecular Properties
| Compound Name | (11Z)-1-iminoicosa-1,11-dien-3-one |
| PubChem CID | 20838345 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | (11Z)-1-iminoicosa-1,11-dien-3-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C=C=N |
| InChI | InChI=1S/C20H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)18-19-21/h9-10,18,21H,2-8,11-17H2,1H3/b10-9- |
| InChIKey | LSQDZPWDMNENRT-KTKRTIGZSA-N |
| XLogP | 6.40 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (11Z)-1-iminoicosa-1,11-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11Z)-1-iminoicosa-1,11-dien-3-one?
The IUPAC name of (11Z)-1-iminoicosa-1,11-dien-3-one (CID 20838345) is (11Z)-1-iminoicosa-1,11-dien-3-one.
What is the SMILES notation for (11Z)-1-iminoicosa-1,11-dien-3-one?
The canonical SMILES for (11Z)-1-iminoicosa-1,11-dien-3-one is CCCCCCCC/C=C\CCCCCCCC(=O)C=C=N.
What is the InChIKey of (11Z)-1-iminoicosa-1,11-dien-3-one?
The InChIKey is LSQDZPWDMNENRT-KTKRTIGZSA-N. The full InChI is InChI=1S/C20H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)18-19-21/h9-10,18,21H,2-8,11-17H2,1H3/b10-9-.
What are the key properties of (11Z)-1-iminoicosa-1,11-dien-3-one?
(11Z)-1-iminoicosa-1,11-dien-3-one has a molecular weight of 305.51 g/mol, XLogP of 6.40, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (11Z)-1-iminoicosa-1,11-dien-3-one is sourced from PubChem (CID 20838345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).