C23H29ClN2O3 — CID 20838548
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-(4-aminophenyl)-3-phenylprop-2-enoate;hydrate;hydrochloride (PubChem CID 20838548) has the molecular formula C23H29ClN2O3 and a molecular weight of 416.95 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-(4-aminophenyl)-3-phenylprop-2-enoate;hydrate;hydrochloride.
| Compound Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-(4-aminophenyl)-3-phenylprop-2-enoate;hydrate;hydrochloride |
|---|---|
| PubChem CID | 20838548 |
| Molecular Formula | C23H29ClN2O3 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-(4-aminophenyl)-3-phenylprop-2-enoate;hydrate;hydrochloride |
| SMILES | CN1[C@@H]2CC[C@H]1CC(OC(=O)/C(=C/c1ccccc1)c1ccc(N)cc1)C2.Cl.O |
| InChI | InChI=1S/C23H26N2O2.ClH.H2O/c1-25-19-11-12-20(25)15-21(14-19)27-23(26)22(13-16-5-3-2-4-6-16)17-7-9-18(24)10-8-17;;/h2-10,13,19-21H,11-12,14-15,24H2,1H3;1H;1H2/b22-13+;;/t19-,20+,21?;; |
| InChIKey | JLWSCYTXAOZXKE-NQHMYZDKSA-N |
| XLogP | 3.57 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|