C23H27ClN2O6-2 — CID 20838587
(Z)-but-2-enedioate;5-chloro-2,2-dimethyl-N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3H-1-benzofuran-7-carboxamide (PubChem CID 20838587) has the molecular formula C23H27ClN2O6-2 and a molecular weight of 462.93 g/mol. Its IUPAC name is (Z)-but-2-enedioate;5-chloro-2,2-dimethyl-N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3H-1-benzofuran-7-carboxamide.
| Compound Name | (Z)-but-2-enedioate;5-chloro-2,2-dimethyl-N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3H-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 20838587 |
| Molecular Formula | C23H27ClN2O6-2 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (Z)-but-2-enedioate;5-chloro-2,2-dimethyl-N-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3H-1-benzofuran-7-carboxamide |
| SMILES | CN1[C@@H]2CC[C@H]1CC(NC(=O)c1cc(Cl)cc3c1OC(C)(C)C3)C2.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C19H25ClN2O2.C4H4O4/c1-19(2)10-11-6-12(20)7-16(17(11)24-19)18(23)21-13-8-14-4-5-15(9-13)22(14)3;5-3(6)1-2-4(7)8/h6-7,13-15H,4-5,8-10H2,1-3H3,(H,21,23);1-2H,(H,5,6)(H,7,8)/p-2/b;2-1-/t13?,14-,15+; |
| InChIKey | HAFQATMFFHYNPN-BSLJCGBVSA-L |
| XLogP | 0.45 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|