About iodomethane;1-[(E)-2-phenylethenyl]piperidine
iodomethane;1-[(E)-2-phenylethenyl]piperidine (PubChem CID 20839071) has the molecular formula C14H20IN
and a molecular weight of 329.22 g/mol. Its IUPAC name is iodomethane;1-[(E)-2-phenylethenyl]piperidine.
Molecular Properties
| Compound Name | iodomethane;1-[(E)-2-phenylethenyl]piperidine |
| PubChem CID | 20839071 |
| Molecular Formula | C14H20IN |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | iodomethane;1-[(E)-2-phenylethenyl]piperidine |
| SMILES | C(=C/N1CCCCC1)\c1ccccc1.CI |
| InChI | InChI=1S/C13H17N.CH3I/c1-3-7-13(8-4-1)9-12-14-10-5-2-6-11-14;1-2/h1,3-4,7-9,12H,2,5-6,10-11H2;1H3/b12-9+; |
| InChIKey | VRMZLSAHJLWHCO-NBYYMMLRSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethane;1-[(E)-2-phenylethenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethane;1-[(E)-2-phenylethenyl]piperidine?
The IUPAC name of iodomethane;1-[(E)-2-phenylethenyl]piperidine (CID 20839071) is iodomethane;1-[(E)-2-phenylethenyl]piperidine.
What is the SMILES notation for iodomethane;1-[(E)-2-phenylethenyl]piperidine?
The canonical SMILES for iodomethane;1-[(E)-2-phenylethenyl]piperidine is C(=C/N1CCCCC1)\c1ccccc1.CI.
What is the InChIKey of iodomethane;1-[(E)-2-phenylethenyl]piperidine?
The InChIKey is VRMZLSAHJLWHCO-NBYYMMLRSA-N. The full InChI is InChI=1S/C13H17N.CH3I/c1-3-7-13(8-4-1)9-12-14-10-5-2-6-11-14;1-2/h1,3-4,7-9,12H,2,5-6,10-11H2;1H3/b12-9+;.
What are the key properties of iodomethane;1-[(E)-2-phenylethenyl]piperidine?
iodomethane;1-[(E)-2-phenylethenyl]piperidine has a molecular weight of 329.22 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethane;1-[(E)-2-phenylethenyl]piperidine is sourced from PubChem (CID 20839071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).