C39H72O4S — CID 20839408
[2-[(Z)-octadec-9-enoyl]oxy-3-sulfanylpropyl] (Z)-octadec-9-enoate (PubChem CID 20839408) has the molecular formula C39H72O4S and a molecular weight of 637.07 g/mol. Its IUPAC name is [2-[(Z)-octadec-9-enoyl]oxy-3-sulfanylpropyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[(Z)-octadec-9-enoyl]oxy-3-sulfanylpropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 20839408 |
| Molecular Formula | C39H72O4S |
| Molecular Weight | 637.07 g/mol |
| Exact Mass | 636.52 |
| IUPAC Name | [2-[(Z)-octadec-9-enoyl]oxy-3-sulfanylpropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CS)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H72O4S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(40)42-35-37(36-44)43-39(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,44H,3-16,21-36H2,1-2H3/b19-17-,20-18- |
| InChIKey | UKOGRBIPECFQHH-CLFAGFIQSA-N |
| XLogP | 12.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.07 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|