About but-1-en-2-yl 2-(3-methylbutoxy)acetate
but-1-en-2-yl 2-(3-methylbutoxy)acetate (PubChem CID 20839562) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is but-1-en-2-yl 2-(3-methylbutoxy)acetate.
Molecular Properties
| Compound Name | but-1-en-2-yl 2-(3-methylbutoxy)acetate |
| PubChem CID | 20839562 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | but-1-en-2-yl 2-(3-methylbutoxy)acetate |
| SMILES | C=C(CC)OC(=O)COCCC(C)C |
| InChI | InChI=1S/C11H20O3/c1-5-10(4)14-11(12)8-13-7-6-9(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | WUWSVFZAGYUXMC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze but-1-en-2-yl 2-(3-methylbutoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-en-2-yl 2-(3-methylbutoxy)acetate?
The IUPAC name of but-1-en-2-yl 2-(3-methylbutoxy)acetate (CID 20839562) is but-1-en-2-yl 2-(3-methylbutoxy)acetate.
What is the SMILES notation for but-1-en-2-yl 2-(3-methylbutoxy)acetate?
The canonical SMILES for but-1-en-2-yl 2-(3-methylbutoxy)acetate is C=C(CC)OC(=O)COCCC(C)C.
What is the InChIKey of but-1-en-2-yl 2-(3-methylbutoxy)acetate?
The InChIKey is WUWSVFZAGYUXMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-5-10(4)14-11(12)8-13-7-6-9(2)3/h9H,4-8H2,1-3H3.
What are the key properties of but-1-en-2-yl 2-(3-methylbutoxy)acetate?
but-1-en-2-yl 2-(3-methylbutoxy)acetate has a molecular weight of 200.28 g/mol, XLogP of 2.52, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-en-2-yl 2-(3-methylbutoxy)acetate is sourced from PubChem (CID 20839562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).