C24H24N2O5 — CID 20840042
(Z)-but-2-enedioic acid;2-[2-(dimethylamino)ethoxy]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carbonitrile (PubChem CID 20840042) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[2-(dimethylamino)ethoxy]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carbonitrile.
| Compound Name | (Z)-but-2-enedioic acid;2-[2-(dimethylamino)ethoxy]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carbonitrile |
|---|---|
| PubChem CID | 20840042 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[2-(dimethylamino)ethoxy]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carbonitrile |
| SMILES | CN(C)CCOC1c2ccccc2C=C(C#N)c2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H20N2O.C4H4O4/c1-22(2)11-12-23-20-18-9-4-3-7-15(18)13-16(14-21)17-8-5-6-10-19(17)20;5-3(6)1-2-4(7)8/h3-10,13,20H,11-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QSAUVUAYABRSCB-BTJKTKAUSA-N |
| XLogP | 3.44 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|