C19H27ClN2O6 — CID 20840143
(Z)-but-2-enedioic acid;1-(8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-4-methylpiperazine;hydrate (PubChem CID 20840143) has the molecular formula C19H27ClN2O6 and a molecular weight of 414.89 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-4-methylpiperazine;hydrate.
| Compound Name | (Z)-but-2-enedioic acid;1-(8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-4-methylpiperazine;hydrate |
|---|---|
| PubChem CID | 20840143 |
| Molecular Formula | C19H27ClN2O6 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(8-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-4-methylpiperazine;hydrate |
| SMILES | CN1CCN(C2CCCOc3cc(Cl)ccc32)CC1.O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H21ClN2O.C4H4O4.H2O/c1-17-6-8-18(9-7-17)14-3-2-10-19-15-11-12(16)4-5-13(14)15;5-3(6)1-2-4(7)8;/h4-5,11,14H,2-3,6-10H2,1H3;1-2H,(H,5,6)(H,7,8);1H2/b;2-1-; |
| InChIKey | ORSJVVBTMDJTKY-FJOGWHKWSA-N |
| XLogP | 1.69 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|