C17H23NO8S — CID 20840402
(Z)-but-2-enedioic acid;1-(4-methylsulfonylphenyl)-2-morpholin-4-ylethanol (PubChem CID 20840402) has the molecular formula C17H23NO8S and a molecular weight of 401.44 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(4-methylsulfonylphenyl)-2-morpholin-4-ylethanol.
| Compound Name | (Z)-but-2-enedioic acid;1-(4-methylsulfonylphenyl)-2-morpholin-4-ylethanol |
|---|---|
| PubChem CID | 20840402 |
| Molecular Formula | C17H23NO8S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(4-methylsulfonylphenyl)-2-morpholin-4-ylethanol |
| SMILES | CS(=O)(=O)c1ccc(C(O)CN2CCOCC2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H19NO4S.C4H4O4/c1-19(16,17)12-4-2-11(3-5-12)13(15)10-14-6-8-18-9-7-14;5-3(6)1-2-4(7)8/h2-5,13,15H,6-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | LDBZQKUWGRNACT-BTJKTKAUSA-N |
| XLogP | 0.17 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|