About 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid
4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid (PubChem CID 2084071) has the molecular formula C21H20N2O6
and a molecular weight of 396.40 g/mol. Its IUPAC name is 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid |
| PubChem CID | 2084071 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid |
| SMILES | CCOC(=O)c1cc(-c2ccc(OC)cc2OC)nn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H20N2O6/c1-4-29-21(26)18-12-17(16-10-9-15(27-2)11-19(16)28-3)22-23(18)14-7-5-13(6-8-14)20(24)25/h5-12H,4H2,1-3H3,(H,24,25) |
| InChIKey | AKLWHCLVFSITCG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid?
The IUPAC name of 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid (CID 2084071) is 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid.
What is the SMILES notation for 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid?
The canonical SMILES for 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid is CCOC(=O)c1cc(-c2ccc(OC)cc2OC)nn1-c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid?
The InChIKey is AKLWHCLVFSITCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O6/c1-4-29-21(26)18-12-17(16-10-9-15(27-2)11-19(16)28-3)22-23(18)14-7-5-13(6-8-14)20(24)25/h5-12H,4H2,1-3H3,(H,24,25).
What are the key properties of 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid?
4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid has a molecular weight of 396.40 g/mol, XLogP of 3.43, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,4-dimethoxyphenyl)-5-ethoxycarbonylpyrazol-1-yl]benzoic acid is sourced from PubChem (CID 2084071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).