C38H36ClF3N2O4S — CID 20840792
1-[4,4-bis(4-fluorophenyl)butyl]-4-(3-chloro-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(Z)-but-2-enedioic acid (PubChem CID 20840792) has the molecular formula C38H36ClF3N2O4S and a molecular weight of 709.23 g/mol. Its IUPAC name is 1-[4,4-bis(4-fluorophenyl)butyl]-4-(3-chloro-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(Z)-but-2-enedioic acid.
| Compound Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-(3-chloro-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 20840792 |
| Molecular Formula | C38H36ClF3N2O4S |
| Molecular Weight | 709.23 g/mol |
| Exact Mass | 708.20 |
| IUPAC Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-(3-chloro-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(Z)-but-2-enedioic acid |
| SMILES | Fc1ccc(C(CCCN2CCN(C3Cc4ccc(F)cc4Sc4ccc(Cl)cc43)CC2)c2ccc(F)cc2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C34H32ClF3N2S.C4H4O4/c35-26-8-14-33-31(21-26)32(20-25-7-13-29(38)22-34(25)41-33)40-18-16-39(17-19-40)15-1-2-30(23-3-9-27(36)10-4-23)24-5-11-28(37)12-6-24;5-3(6)1-2-4(7)8/h3-14,21-22,30,32H,1-2,15-20H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QXFRURKKTMSLNP-BTJKTKAUSA-N |
| XLogP | 8.45 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.23 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|