C23H30NO10-3 — CID 20840885
(Z)-3-[2-[2-(diethylamino)ethoxy]phenoxy]pent-3-en-2-one;2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 20840885) has the molecular formula C23H30NO10-3 and a molecular weight of 480.49 g/mol. Its IUPAC name is (Z)-3-[2-[2-(diethylamino)ethoxy]phenoxy]pent-3-en-2-one;2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | (Z)-3-[2-[2-(diethylamino)ethoxy]phenoxy]pent-3-en-2-one;2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 20840885 |
| Molecular Formula | C23H30NO10-3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (Z)-3-[2-[2-(diethylamino)ethoxy]phenoxy]pent-3-en-2-one;2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | C/C=C(\Oc1ccccc1OCCN(CC)CC)C(C)=O.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C17H25NO3.C6H8O7/c1-5-15(14(4)19)21-17-11-9-8-10-16(17)20-13-12-18(6-2)7-3;7-3(8)1-6(13,5(11)12)2-4(9)10/h5,8-11H,6-7,12-13H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-3/b15-5-; |
| InChIKey | AJLUDXKSGVACKS-PZTRBQFESA-K |
| XLogP | -1.97 |
| TPSA | 179.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|