About 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate
1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate (PubChem CID 20841231) has the molecular formula C17H16BrNO4S2-2
and a molecular weight of 442.36 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate.
Molecular Properties
| Compound Name | 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate |
| PubChem CID | 20841231 |
| Molecular Formula | C17H16BrNO4S2-2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate |
| SMILES | CN(C)Cc1ccccc1Sc1ccc(Br)s1.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C13H14BrNS2.C4H4O4/c1-15(2)9-10-5-3-4-6-11(10)16-13-8-7-12(14)17-13;5-3(6)1-2-4(7)8/h3-8H,9H2,1-2H3;1-2H,(H,5,6)(H,7,8)/p-2/b;2-1- |
| InChIKey | XHKYSBOSLISUON-BTJKTKAUSA-L |
| XLogP | 1.77 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate?
The IUPAC name of 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate (CID 20841231) is 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate.
What is the SMILES notation for 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate?
The canonical SMILES for 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate is CN(C)Cc1ccccc1Sc1ccc(Br)s1.O=C([O-])/C=C\C(=O)[O-].
What is the InChIKey of 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate?
The InChIKey is XHKYSBOSLISUON-BTJKTKAUSA-L. The full InChI is InChI=1S/C13H14BrNS2.C4H4O4/c1-15(2)9-10-5-3-4-6-11(10)16-13-8-7-12(14)17-13;5-3(6)1-2-4(7)8/h3-8H,9H2,1-2H3;1-2H,(H,5,6)(H,7,8)/p-2/b;2-1-.
What are the key properties of 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate?
1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate has a molecular weight of 442.36 g/mol, XLogP of 1.77, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5-bromothiophen-2-yl)sulfanylphenyl]-N,N-dimethylmethanamine;(Z)-but-2-enedioate is sourced from PubChem (CID 20841231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).