About 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol
2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol (PubChem CID 20841385) has the molecular formula C22H43NO2
and a molecular weight of 353.59 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol |
| PubChem CID | 20841385 |
| Molecular Formula | C22H43NO2 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.33 |
| IUPAC Name | 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCO)CCO |
| InChI | InChI=1S/C22H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(19-21-24)20-22-25/h6-7,9-10,24-25H,2-5,8,11-22H2,1H3/b7-6-,10-9- |
| InChIKey | ZTGPMSMCXDRUOY-HZJYTTRNSA-N |
| XLogP | 5.09 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol?
The IUPAC name of 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol (CID 20841385) is 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol.
What is the SMILES notation for 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol?
The canonical SMILES for 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol is CCCCC/C=C\C/C=C\CCCCCCCCN(CCO)CCO.
What is the InChIKey of 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol?
The InChIKey is ZTGPMSMCXDRUOY-HZJYTTRNSA-N. The full InChI is InChI=1S/C22H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(19-21-24)20-22-25/h6-7,9-10,24-25H,2-5,8,11-22H2,1H3/b7-6-,10-9-.
What are the key properties of 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol?
2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol has a molecular weight of 353.59 g/mol, XLogP of 5.09, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethanol is sourced from PubChem (CID 20841385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).