C11H12O4S2Sn — CID 20841861
7-phenyl-1,3,6,8,2-dioxadithiastannecane-4,10-dione (PubChem CID 20841861) has the molecular formula C11H12O4S2Sn and a molecular weight of 391.06 g/mol. Its IUPAC name is 7-phenyl-1,3,6,8,2-dioxadithiastannecane-4,10-dione.
| Compound Name | 7-phenyl-1,3,6,8,2-dioxadithiastannecane-4,10-dione |
|---|---|
| PubChem CID | 20841861 |
| Molecular Formula | C11H12O4S2Sn |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | 7-phenyl-1,3,6,8,2-dioxadithiastannecane-4,10-dione |
| SMILES | O=C1CSC(c2ccccc2)SCC(=O)O[SnH2]O1 |
| InChI | InChI=1S/C11H12O4S2.Sn.2H/c12-9(13)6-16-11(17-7-10(14)15)8-4-2-1-3-5-8;;;/h1-5,11H,6-7H2,(H,12,13)(H,14,15);;;/q;+2;;/p-2 |
| InChIKey | ZJSHJDUZSRCDHF-UHFFFAOYSA-L |
| XLogP | 1.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |