C17H19ClN4S — CID 20842152
5-[(2E,5E)-4-(4-chlorophenyl)sulfanylhepta-2,5-dienyl]-6-methyl-1,2,4-triazin-3-amine (PubChem CID 20842152) has the molecular formula C17H19ClN4S and a molecular weight of 346.89 g/mol. Its IUPAC name is 5-[(2E,5E)-4-(4-chlorophenyl)sulfanylhepta-2,5-dienyl]-6-methyl-1,2,4-triazin-3-amine.
| Compound Name | 5-[(2E,5E)-4-(4-chlorophenyl)sulfanylhepta-2,5-dienyl]-6-methyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 20842152 |
| Molecular Formula | C17H19ClN4S |
| Molecular Weight | 346.89 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 5-[(2E,5E)-4-(4-chlorophenyl)sulfanylhepta-2,5-dienyl]-6-methyl-1,2,4-triazin-3-amine |
| SMILES | C/C=C/C(/C=C/Cc1nc(N)nnc1C)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN4S/c1-3-5-14(23-15-10-8-13(18)9-11-15)6-4-7-16-12(2)21-22-17(19)20-16/h3-6,8-11,14H,7H2,1-2H3,(H2,19,20,22)/b5-3+,6-4+ |
| InChIKey | SFQFRLTYNFRTDZ-GGWOSOGESA-N |
| XLogP | 4.25 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|