C25H43ClNO+ — CID 20842425
(4E,6E)-4,8,12-trimethyl-1-(4-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium-1-yl)trideca-4,6,11-trien-3-one;hydrochloride (PubChem CID 20842425) has the molecular formula C25H43ClNO+ and a molecular weight of 409.08 g/mol. Its IUPAC name is (4E,6E)-4,8,12-trimethyl-1-(4-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium-1-yl)trideca-4,6,11-trien-3-one;hydrochloride.
| Compound Name | (4E,6E)-4,8,12-trimethyl-1-(4-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium-1-yl)trideca-4,6,11-trien-3-one;hydrochloride |
|---|---|
| PubChem CID | 20842425 |
| Molecular Formula | C25H43ClNO+ |
| Molecular Weight | 409.08 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | (4E,6E)-4,8,12-trimethyl-1-(4-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium-1-yl)trideca-4,6,11-trien-3-one;hydrochloride |
| SMILES | CC(C)=CCCC(C)/C=C/C=C(\C)C(=O)CCC1CC[N+]2(C)CCCCC12.Cl |
| InChI | InChI=1S/C25H42NO.ClH/c1-20(2)10-8-11-21(3)12-9-13-22(4)25(27)16-15-23-17-19-26(5)18-7-6-14-24(23)26;/h9-10,12-13,21,23-24H,6-8,11,14-19H2,1-5H3;1H/q+1;/b12-9+,22-13+; |
| InChIKey | ZLMQGIWYFHZXSJ-DVCYCMHMSA-N |
| XLogP | 6.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.08 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|