About [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine
[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine (PubChem CID 20842904) has the molecular formula C9H8FN3S
and a molecular weight of 209.25 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine |
| PubChem CID | 20842904 |
| Molecular Formula | C9H8FN3S |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine |
| SMILES | NCc1nnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C9H8FN3S/c10-7-3-1-6(2-4-7)9-13-12-8(5-11)14-9/h1-4H,5,11H2 |
| InChIKey | KAFGTIBHXHBTBN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine?
The IUPAC name of [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine (CID 20842904) is [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine.
What is the SMILES notation for [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine?
The canonical SMILES for [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine is NCc1nnc(-c2ccc(F)cc2)s1.
What is the InChIKey of [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine?
The InChIKey is KAFGTIBHXHBTBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3S/c10-7-3-1-6(2-4-7)9-13-12-8(5-11)14-9/h1-4H,5,11H2.
What are the key properties of [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine?
[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine has a molecular weight of 209.25 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]methanamine is sourced from PubChem (CID 20842904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).