About 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium
2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium (PubChem CID 20843860) has the molecular formula C8H20N3S+
and a molecular weight of 190.34 g/mol. Its IUPAC name is 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium.
Molecular Properties
| Compound Name | 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium |
| PubChem CID | 20843860 |
| Molecular Formula | C8H20N3S+ |
| Molecular Weight | 190.34 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium |
| SMILES | CC/N=C(\N)SCC[N+](C)(C)C |
| InChI | InChI=1S/C8H20N3S/c1-5-10-8(9)12-7-6-11(2,3)4/h5-7H2,1-4H3,(H2,9,10)/q+1 |
| InChIKey | ZGXTWHWPMLKGKP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium?
The IUPAC name of 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium (CID 20843860) is 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium.
What is the SMILES notation for 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium?
The canonical SMILES for 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium is CC/N=C(\N)SCC[N+](C)(C)C.
What is the InChIKey of 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium?
The InChIKey is ZGXTWHWPMLKGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N3S/c1-5-10-8(9)12-7-6-11(2,3)4/h5-7H2,1-4H3,(H2,9,10)/q+1.
What are the key properties of 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium?
2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium has a molecular weight of 190.34 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N'-ethylcarbamimidoyl)sulfanylethyl-trimethylazanium is sourced from PubChem (CID 20843860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).