About 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine
1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine (PubChem CID 20844132) has the molecular formula C11H16N4O4
and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine.
Molecular Properties
| Compound Name | 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine |
| PubChem CID | 20844132 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine |
| SMILES | [H]/N=C(\N)N(O)/N=C/c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C11H16N4O4/c1-17-8-5-10(19-3)9(18-2)4-7(8)6-14-15(16)11(12)13/h4-6,16H,1-3H3,(H3,12,13)/b14-6+ |
| InChIKey | CLFWMDZXKOCBNM-MKMNVTDBSA-N |
| XLogP | 0.63 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine?
The IUPAC name of 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine (CID 20844132) is 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine.
What is the SMILES notation for 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine?
The canonical SMILES for 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine is [H]/N=C(\N)N(O)/N=C/c1cc(OC)c(OC)cc1OC.
What is the InChIKey of 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine?
The InChIKey is CLFWMDZXKOCBNM-MKMNVTDBSA-N. The full InChI is InChI=1S/C11H16N4O4/c1-17-8-5-10(19-3)9(18-2)4-7(8)6-14-15(16)11(12)13/h4-6,16H,1-3H3,(H3,12,13)/b14-6+.
What are the key properties of 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine?
1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine has a molecular weight of 268.27 g/mol, XLogP of 0.63, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-1-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]guanidine is sourced from PubChem (CID 20844132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).