C16H24Cl3N7O2 — CID 20844177
3-N-[(E)-[4-[bis(2-chloroethyl)amino]-2,5-dimethoxyphenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 20844177) has the molecular formula C16H24Cl3N7O2 and a molecular weight of 452.77 g/mol. Its IUPAC name is 3-N-[(E)-[4-[bis(2-chloroethyl)amino]-2,5-dimethoxyphenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(E)-[4-[bis(2-chloroethyl)amino]-2,5-dimethoxyphenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 20844177 |
| Molecular Formula | C16H24Cl3N7O2 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 3-N-[(E)-[4-[bis(2-chloroethyl)amino]-2,5-dimethoxyphenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | COc1cc(N(CCCl)CCCl)c(OC)cc1/C=N/Nc1nnc(C)n1N.Cl |
| InChI | InChI=1S/C16H23Cl2N7O2.ClH/c1-11-21-23-16(25(11)19)22-20-10-12-8-15(27-3)13(9-14(12)26-2)24(6-4-17)7-5-18;/h8-10H,4-7,19H2,1-3H3,(H,22,23);1H/b20-10+; |
| InChIKey | XZDBBANCHPWAPJ-XZISABOOSA-N |
| XLogP | 2.47 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|