C25H25N3O2 — CID 20845213
(4-benzhydrylpiperazin-1-yl)-(1,3-benzodioxol-5-yl)methanimine (PubChem CID 20845213) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-(1,3-benzodioxol-5-yl)methanimine.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-(1,3-benzodioxol-5-yl)methanimine |
|---|---|
| PubChem CID | 20845213 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-(1,3-benzodioxol-5-yl)methanimine |
| SMILES | [H]/N=C(/c1ccc2c(c1)OCO2)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H25N3O2/c26-25(21-11-12-22-23(17-21)30-18-29-22)28-15-13-27(14-16-28)24(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17,24,26H,13-16,18H2/b26-25- |
| InChIKey | LATBCGBZUISHOQ-QPLCGJKRSA-N |
| XLogP | 4.15 |
| TPSA | 48.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|