C17H11N7 — CID 20845280
4-[(E)-C-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)carbonohydrazonoyl]benzonitrile (PubChem CID 20845280) has the molecular formula C17H11N7 and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-[(E)-C-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)carbonohydrazonoyl]benzonitrile.
| Compound Name | 4-[(E)-C-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)carbonohydrazonoyl]benzonitrile |
|---|---|
| PubChem CID | 20845280 |
| Molecular Formula | C17H11N7 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[(E)-C-(5H-[1,2,4]triazino[5,6-b]indol-3-yl)carbonohydrazonoyl]benzonitrile |
| SMILES | N#Cc1ccc(/C(=N\N)c2nnc3c(n2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C17H11N7/c18-9-10-5-7-11(8-6-10)14(22-19)17-21-16-15(23-24-17)12-3-1-2-4-13(12)20-16/h1-8H,19H2,(H,20,21,24)/b22-14+ |
| InChIKey | JHAKXMUOJYBTKW-HYARGMPZSA-N |
| XLogP | 2.09 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|