C16H39NO5Si3 — CID 20845407
(E,2S,3S,4R)-N,3-dimethoxy-2,4,5-tris(trimethylsilyloxy)pentan-1-imine (PubChem CID 20845407) has the molecular formula C16H39NO5Si3 and a molecular weight of 409.75 g/mol. Its IUPAC name is (E,2S,3S,4R)-N,3-dimethoxy-2,4,5-tris(trimethylsilyloxy)pentan-1-imine.
| Compound Name | (E,2S,3S,4R)-N,3-dimethoxy-2,4,5-tris(trimethylsilyloxy)pentan-1-imine |
|---|---|
| PubChem CID | 20845407 |
| Molecular Formula | C16H39NO5Si3 |
| Molecular Weight | 409.75 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (E,2S,3S,4R)-N,3-dimethoxy-2,4,5-tris(trimethylsilyloxy)pentan-1-imine |
| SMILES | CO/N=C/[C@H](O[Si](C)(C)C)[C@H](OC)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H39NO5Si3/c1-18-16(14(12-17-19-2)21-24(6,7)8)15(22-25(9,10)11)13-20-23(3,4)5/h12,14-16H,13H2,1-11H3/b17-12+/t14-,15+,16-/m0/s1 |
| InChIKey | XFTDTOSLXSCVFT-ZMUYCKRWSA-N |
| XLogP | 3.93 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|