About N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide
N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide (PubChem CID 20846817) has the molecular formula C19H23N3O3S
and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide.
Molecular Properties
| Compound Name | N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide |
| PubChem CID | 20846817 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)C(C)Sc2ccccn2)cc1OCC |
| InChI | InChI=1S/C19H23N3O3S/c1-4-24-16-10-9-15(12-17(16)25-5-2)13-21-22-19(23)14(3)26-18-8-6-7-11-20-18/h6-14H,4-5H2,1-3H3,(H,22,23)/b21-13+ |
| InChIKey | LDOXHTDIAVGFMD-FYJGNVAPSA-N |
| XLogP | 3.51 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide?
The IUPAC name of N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide (CID 20846817) is N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide.
What is the SMILES notation for N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide?
The canonical SMILES for N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide is CCOc1ccc(/C=N/NC(=O)C(C)Sc2ccccn2)cc1OCC.
What is the InChIKey of N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide?
The InChIKey is LDOXHTDIAVGFMD-FYJGNVAPSA-N. The full InChI is InChI=1S/C19H23N3O3S/c1-4-24-16-10-9-15(12-17(16)25-5-2)13-21-22-19(23)14(3)26-18-8-6-7-11-20-18/h6-14H,4-5H2,1-3H3,(H,22,23)/b21-13+.
What are the key properties of N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide?
N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide has a molecular weight of 373.48 g/mol, XLogP of 3.51, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(3,4-diethoxyphenyl)methylideneamino]-2-pyridin-2-ylsulfanylpropanamide is sourced from PubChem (CID 20846817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).