C22H34O2 — CID 20847477
2-[(1S,2E,6Z,10Z,12Z)-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,10,12-tetraen-1-yl]acetic acid (PubChem CID 20847477) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 2-[(1S,2E,6Z,10Z,12Z)-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,10,12-tetraen-1-yl]acetic acid.
| Compound Name | 2-[(1S,2E,6Z,10Z,12Z)-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,10,12-tetraen-1-yl]acetic acid |
|---|---|
| PubChem CID | 20847477 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 2-[(1S,2E,6Z,10Z,12Z)-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,10,12-tetraen-1-yl]acetic acid |
| SMILES | C/C1=C/CC/C(C)=C/[C@H](CC(=O)O)C/C(C)=C/C=C(\C(C)C)CC1 |
| InChI | InChI=1S/C22H34O2/c1-16(2)21-11-9-17(3)7-6-8-18(4)13-20(15-22(23)24)14-19(5)10-12-21/h7,10,12-13,16,20H,6,8-9,11,14-15H2,1-5H3,(H,23,24)/b17-7-,18-13+,19-10+,21-12-/t20-/m0/s1 |
| InChIKey | XOGJWIVDFUBPHR-YVAXXTGMSA-N |
| XLogP | 6.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|