C11H20N2O4 — CID 20847506
1,2,3,6-tetrahydropyridine-2-carboxylic acid;2-(trimethylazaniumyl)acetate (PubChem CID 20847506) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridine-2-carboxylic acid;2-(trimethylazaniumyl)acetate.
| Compound Name | 1,2,3,6-tetrahydropyridine-2-carboxylic acid;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 20847506 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1,2,3,6-tetrahydropyridine-2-carboxylic acid;2-(trimethylazaniumyl)acetate |
| SMILES | C[N+](C)(C)CC(=O)[O-].O=C(O)C1CC=CCN1 |
| InChI | InChI=1S/C6H9NO2.C5H11NO2/c8-6(9)5-3-1-2-4-7-5;1-6(2,3)4-5(7)8/h1-2,5,7H,3-4H2,(H,8,9);4H2,1-3H3 |
| InChIKey | CPEWRPISSHYAIV-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|