About 4H-naphthalen-4a-ol
4H-naphthalen-4a-ol (PubChem CID 20847521) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 4H-naphthalen-4a-ol.
Molecular Properties
| Compound Name | 4H-naphthalen-4a-ol |
| PubChem CID | 20847521 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 4H-naphthalen-4a-ol |
| SMILES | OC12C=CC=CC1=CC=CC2 |
| InChI | InChI=1S/C10H10O/c11-10-7-3-1-5-9(10)6-2-4-8-10/h1-7,11H,8H2 |
| InChIKey | CKFYOKZUDLOSQW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-naphthalen-4a-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-naphthalen-4a-ol?
The IUPAC name of 4H-naphthalen-4a-ol (CID 20847521) is 4H-naphthalen-4a-ol.
What is the SMILES notation for 4H-naphthalen-4a-ol?
The canonical SMILES for 4H-naphthalen-4a-ol is OC12C=CC=CC1=CC=CC2.
What is the InChIKey of 4H-naphthalen-4a-ol?
The InChIKey is CKFYOKZUDLOSQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c11-10-7-3-1-5-9(10)6-2-4-8-10/h1-7,11H,8H2.
What are the key properties of 4H-naphthalen-4a-ol?
4H-naphthalen-4a-ol has a molecular weight of 146.19 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-naphthalen-4a-ol is sourced from PubChem (CID 20847521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).