C16H25NS — CID 20847730
(1S,3aR,4R,8aR)-4-isothiocyanato-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydro-1H-azulene (PubChem CID 20847730) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is (1S,3aR,4R,8aR)-4-isothiocyanato-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydro-1H-azulene.
| Compound Name | (1S,3aR,4R,8aR)-4-isothiocyanato-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydro-1H-azulene |
|---|---|
| PubChem CID | 20847730 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (1S,3aR,4R,8aR)-4-isothiocyanato-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydro-1H-azulene |
| SMILES | CC(C)C1=C[C@@H]2[C@@H](CC[C@@H]2C)[C@](C)(N=C=S)CC1 |
| InChI | InChI=1S/C16H25NS/c1-11(2)13-7-8-16(4,17-10-18)15-6-5-12(3)14(15)9-13/h9,11-12,14-15H,5-8H2,1-4H3/t12-,14-,15+,16+/m0/s1 |
| InChIKey | BJUXAFSYNWNLTL-ARLBYUKCSA-N |
| XLogP | 4.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|