C28H48O4 — CID 20847785
(8S,9R,10S,13R,14S,17R)-10-(hydroxymethyl)-13-methyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,6,9-triol (PubChem CID 20847785) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,17R)-10-(hydroxymethyl)-13-methyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,6,9-triol.
| Compound Name | (8S,9R,10S,13R,14S,17R)-10-(hydroxymethyl)-13-methyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,6,9-triol |
|---|---|
| PubChem CID | 20847785 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | (8S,9R,10S,13R,14S,17R)-10-(hydroxymethyl)-13-methyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,5,6,7,8,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,6,9-triol |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(O)C4CC(O)CC[C@]4(CO)[C@@]3(O)CC[C@]12C)C(C)C |
| InChI | InChI=1S/C28H48O4/c1-17(2)18(3)6-7-19(4)21-8-9-22-23-15-25(31)24-14-20(30)10-11-27(24,16-29)28(23,32)13-12-26(21,22)5/h17,19-25,29-32H,3,6-16H2,1-2,4-5H3/t19-,20?,21-,22+,23+,24?,25?,26-,27-,28-/m1/s1 |
| InChIKey | IXRQKODUBYDRKP-VUXBERCWSA-N |
| XLogP | 4.69 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|