About 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride
6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride (PubChem CID 20847933) has the molecular formula C5H10ClN3O
and a molecular weight of 163.61 g/mol. Its IUPAC name is 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride |
| PubChem CID | 20847933 |
| Molecular Formula | C5H10ClN3O |
| Molecular Weight | 163.61 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride |
| SMILES | CN1CCC(N)=NC1=O.Cl |
| InChI | InChI=1S/C5H9N3O.ClH/c1-8-3-2-4(6)7-5(8)9;/h2-3H2,1H3,(H2,6,7,9);1H |
| InChIKey | NHMBCILBNZBUNQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.61 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride?
The IUPAC name of 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride (CID 20847933) is 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride.
What is the SMILES notation for 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride?
The canonical SMILES for 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride is CN1CCC(N)=NC1=O.Cl.
What is the InChIKey of 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride?
The InChIKey is NHMBCILBNZBUNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O.ClH/c1-8-3-2-4(6)7-5(8)9;/h2-3H2,1H3,(H2,6,7,9);1H.
What are the key properties of 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride?
6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride has a molecular weight of 163.61 g/mol, XLogP of 0.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-methyl-4,5-dihydropyrimidin-2-one;hydrochloride is sourced from PubChem (CID 20847933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).