C19H30O7S — CID 20848952
(8S,9S,10S,13R,14S,16R)-1,16-dihydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;sulfuric acid (PubChem CID 20848952) has the molecular formula C19H30O7S and a molecular weight of 402.51 g/mol. Its IUPAC name is (8S,9S,10S,13R,14S,16R)-1,16-dihydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;sulfuric acid.
| Compound Name | (8S,9S,10S,13R,14S,16R)-1,16-dihydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;sulfuric acid |
|---|---|
| PubChem CID | 20848952 |
| Molecular Formula | C19H30O7S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (8S,9S,10S,13R,14S,16R)-1,16-dihydroxy-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;sulfuric acid |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CC(=O)C=C(O)[C@@]43C)[C@@H]1C[C@@H](O)C2.O=S(=O)(O)O |
| InChI | InChI=1S/C19H28O3.H2O4S/c1-18-6-5-15-14(16(18)8-13(21)10-18)4-3-11-7-12(20)9-17(22)19(11,15)2;1-5(2,3)4/h9,11,13-16,21-22H,3-8,10H2,1-2H3;(H2,1,2,3,4)/t11?,13-,14-,15+,16+,18-,19+;/m1./s1 |
| InChIKey | OTSQYIRQHNERIJ-SNEUFBQASA-N |
| XLogP | 2.97 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|